CAS 1951425-09-4 is the registry number for (R)-3-Amino-1-(2,4-dimethoxybenzyl) pyrrolidin-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3R)-3-amino-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one;hydrochloride (CAS 1951425-09-4) is a chemical compound with the molecular formula C13H19ClN2O3 and a molecular weight of 286.75 g/mol. IUPAC name: (3R)-3-amino-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one;hydrochloride. InChIKey: WSCAAYUECJKGTK-RFVHGSKJSA-N.
| Molecular formula | C13H19ClN2O3 |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | (3R)-3-amino-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one;hydrochloride |
| InChIKey | WSCAAYUECJKGTK-RFVHGSKJSA-N |
| SMILES | COC1=CC(=C(C=C1)CN2CC[C@H](C2=O)N)OC.Cl |
Computed by PubChem (NCBI)