Products 1142192-06-0
CAS 1142192-06-0 is the registry number for N-(2-Chloro-6-(dimethoxymethyl)pyridin-3-yl)-pivalamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[2-chloro-6-(dimethoxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide (CAS 1142192-06-0) is a chemical compound with the molecular formula C13H19ClN2O3 and a molecular weight of 286.75 g/mol. IUPAC name: N-[2-chloro-6-(dimethoxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide. InChIKey: IBYNTMNMQOXZNC-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O3 |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | N-[2-chloro-6-(dimethoxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide |
| InChIKey | IBYNTMNMQOXZNC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(N=C(C=C1)C(OC)OC)Cl |
Computed by PubChem (NCBI)