cas: 18065-05-9 — see every product listed under this CAS number, including other names
1-(2,4-Bis(benzyloxy)-6-hydroxyphenyl)ethanone, 98% (CAS 18065-05-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F229499-250MG |
| cas | 18065-05-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 789.32 Pln | |
| Fluorochem | 10g | 1388.07 Pln | |
| Fluorochem | 25g | 2549.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone (CAS 18065-05-9) is a chemical compound with the molecular formula C22H20O4 and a molecular weight of 348.4 g/mol. IUPAC name: 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone. InChIKey: HEHTYXOPJQUNOF-UHFFFAOYSA-N.
| Molecular formula | C22H20O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone |
| InChIKey | HEHTYXOPJQUNOF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)