cas: 18065-05-9 — see every product listed under this CAS number, including other names
2-Acetyl-3,5-bis(benzyloxy)phenol 98% (CAS 18065-05-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A746836-250mg |
| cas | 18065-05-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 25g | 2105.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A746836 |
1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone (CAS 18065-05-9) is a chemical compound with the molecular formula C22H20O4 and a molecular weight of 348.4 g/mol. IUPAC name: 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone. InChIKey: HEHTYXOPJQUNOF-UHFFFAOYSA-N.
| Molecular formula | C22H20O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone |
| InChIKey | HEHTYXOPJQUNOF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)