cas: 18065-05-9 — see every product listed under this CAS number, including other names
Ethanone, 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]-, 98%, 98% (CAS 18065-05-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113396-250mg |
| cas | 18065-05-9 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 794.00 Pln | |
| Chemat | 25g | 1595.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone (CAS 18065-05-9) is a chemical compound with the molecular formula C22H20O4 and a molecular weight of 348.4 g/mol. IUPAC name: 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone. InChIKey: HEHTYXOPJQUNOF-UHFFFAOYSA-N.
| Molecular formula | C22H20O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone |
| InChIKey | HEHTYXOPJQUNOF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)