cas: 66353-47-7 — see every product listed under this CAS number, including other names
1-(2,4-Dichlorophenyl)butan-1-one (CAS 66353-47-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226872-5G |
| cas | 66353-47-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 362.39 Pln |
| delivery time | 3-4 weeks |
|---|
1-(2,4-dichlorophenyl)butan-1-one (CAS 66353-47-7) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)butan-1-one. InChIKey: FXCJYMLJTUZGDU-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)butan-1-one |
| InChIKey | FXCJYMLJTUZGDU-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)