cas: 66353-47-7 — see every product listed under this CAS number, including other names
1-(2,4-dichlorophenyl)-1-butanone, 98%, 98% (CAS 66353-47-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FRA-1g |
| cas | 66353-47-7 |
| size | 1g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 242.00 Pln | |
| Chemat | 500g | 873.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(2,4-dichlorophenyl)butan-1-one (CAS 66353-47-7) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)butan-1-one. InChIKey: FXCJYMLJTUZGDU-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)butan-1-one |
| InChIKey | FXCJYMLJTUZGDU-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)