Products 1369950-96-8
CAS 1369950-96-8 is the registry number for 1,2-dichloro-4-(cyclopropylmethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,2-dichloro-4-(cyclopropylmethoxy)benzene (CAS 1369950-96-8) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 1,2-dichloro-4-(cyclopropylmethoxy)benzene. InChIKey: QTQRABRNTXYFEF-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 1,2-dichloro-4-(cyclopropylmethoxy)benzene |
| InChIKey | QTQRABRNTXYFEF-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)