cas: 265654-77-1 — see every product listed under this CAS number, including other names
1-(2-(4-Nitrophenoxy)ethyl)pyrrolidine, 95% (CAS 265654-77-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211609-1G |
| cas | 265654-77-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1445.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-[2-(4-nitrophenoxy)ethyl]pyrrolidine (CAS 265654-77-1) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine. InChIKey: RZIYRKYHMDDHCK-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine |
| InChIKey | RZIYRKYHMDDHCK-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCOC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)