cas: 1193390-01-0 — see every product listed under this CAS number, including other names
1-(2-(Aminomethyl)phenyl)-N-methylmethanesulfonamide hydrochloride, 95% (CAS 1193390-01-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1110952-5g |
| cas | 1193390-01-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10733.38 Pln | |
| AmBeed | 10g | 16065.07 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[2-(aminomethyl)phenyl]-N-methylmethanesulfonamide;hydrochloride (CAS 1193390-01-0) is a chemical compound with the molecular formula C9H15ClN2O2S and a molecular weight of 250.75 g/mol. IUPAC name: 1-[2-(aminomethyl)phenyl]-N-methylmethanesulfonamide;hydrochloride. InChIKey: KGLXQWDEXZEGKJ-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2S |
|---|---|
| Molecular weight | 250.75 g/mol |
| IUPAC name | 1-[2-(aminomethyl)phenyl]-N-methylmethanesulfonamide;hydrochloride |
| InChIKey | KGLXQWDEXZEGKJ-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC=CC=C1CN.Cl |
Computed by PubChem (NCBI)