CAS 1221723-71-2 appears in our catalog under these names: 1-(3-(Aminomethyl)phenyl)-N-methylmethanesulfonamide hydrochloride, 95%, 1-(3-(Aminomethyl)phenyl)-N-methylmethanesulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-[3-(aminomethyl)phenyl]-N-methylmethanesulfonamide;hydrochloride (CAS 1221723-71-2) is a chemical compound with the molecular formula C9H15ClN2O2S and a molecular weight of 250.75 g/mol. IUPAC name: 1-[3-(aminomethyl)phenyl]-N-methylmethanesulfonamide;hydrochloride. InChIKey: DTMJSGHIPKEQSJ-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2S |
|---|---|
| Molecular weight | 250.75 g/mol |
| IUPAC name | 1-[3-(aminomethyl)phenyl]-N-methylmethanesulfonamide;hydrochloride |
| InChIKey | DTMJSGHIPKEQSJ-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)