CAS 1156602-97-9 appears in our catalog under these names: 3,5-Dimethyl-1-(2-methylpropyl)-1H-pyrazole-4-sulfonyl chloride, 95%, 3,5-Dimethyl-1-(2-methylpropyl)-1H-pyrazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride (CAS 1156602-97-9) is a chemical compound with the molecular formula C9H15ClN2O2S and a molecular weight of 250.75 g/mol. IUPAC name: 3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride. InChIKey: JJVAWKPCVGZSNI-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2S |
|---|---|
| Molecular weight | 250.75 g/mol |
| IUPAC name | 3,5-dimethyl-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride |
| InChIKey | JJVAWKPCVGZSNI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(C)C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)