cas: 568551-29-1 — see every product listed under this CAS number, including other names
1-(2-(Phenylthio)phenyl)-1H-pyrrole-2,5-dione, 97% (CAS 568551-29-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A559263-10g |
| cas | 568551-29-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16065.07 Pln | |
| AmBeed | 5g | 10733.38 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-phenylsulfanylphenyl)pyrrole-2,5-dione (CAS 568551-29-1) is a chemical compound with the molecular formula C16H11NO2S and a molecular weight of 281.3 g/mol. IUPAC name: 1-(2-phenylsulfanylphenyl)pyrrole-2,5-dione. InChIKey: ONVVECCVKKPNES-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2S |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 1-(2-phenylsulfanylphenyl)pyrrole-2,5-dione |
| InChIKey | ONVVECCVKKPNES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=CC=C2N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)