CAS 568551-29-1 appears in our catalog under these names: 1-(2-Phenylsulfanyl-phenyl)-pyrrole-2,5-dione, 95%, 1-(2-(Phenylthio)phenyl)-1H-pyrrole-2,5-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
1-(2-phenylsulfanylphenyl)pyrrole-2,5-dione (CAS 568551-29-1) is a chemical compound with the molecular formula C16H11NO2S and a molecular weight of 281.3 g/mol. IUPAC name: 1-(2-phenylsulfanylphenyl)pyrrole-2,5-dione. InChIKey: ONVVECCVKKPNES-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2S |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 1-(2-phenylsulfanylphenyl)pyrrole-2,5-dione |
| InChIKey | ONVVECCVKKPNES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=CC=C2N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)