CAS 199915-38-3 appears in our catalog under these names: Fmoc-isothiocyanate, 95%, FMOC isothiocyanate, Fmoc-isothiocyanate, FMOC isothiocyanate, 97%, Fmoc-Isothiocyanate 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 10g.
9H-fluoren-9-ylmethyl N-(sulfanylidenemethylidene)carbamate (CAS 199915-38-3) is a chemical compound with the molecular formula C16H11NO2S and a molecular weight of 281.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(sulfanylidenemethylidene)carbamate. InChIKey: DHMYULZVFHHEHE-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2S |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(sulfanylidenemethylidene)carbamate |
| InChIKey | DHMYULZVFHHEHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N=C=S |
Computed by PubChem (NCBI)