1-(2-Amino-5-fluoro-4-methoxyphenyl)ethan-1-one, 95%
cas: 1444356-81-3 — see every product listed under this CAS number, including other names
1-(2-Amino-5-fluoro-4-methoxyphenyl)ethan-1-one, 95% (CAS 1444356-81-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1117975-100mg |
| cas | 1444356-81-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 5g | 5293.19 Pln | |
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 1816.40 Pln | |
| Chemat | 5g | 5320.40 Pln | |
| BLDpharm | 100mg | 464.31 Pln | |
| BLDpharm | 250mg | 697.56 Pln | |
| BLDpharm | 1g | 1947.12 Pln | |
| BLDpharm | 5g | 5701.35 Pln | |
| Fluorochem | 100mg | 778.91 Pln | |
| Fluorochem | 250mg | 1185.02 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(2-amino-5-fluoro-4-methoxyphenyl)ethanone (CAS 1444356-81-3) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 1-(2-amino-5-fluoro-4-methoxyphenyl)ethanone. InChIKey: QVOLWVXAPXPUQM-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 1-(2-amino-5-fluoro-4-methoxyphenyl)ethanone |
| InChIKey | QVOLWVXAPXPUQM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1N)OC)F |
Computed by PubChem (NCBI)