CAS 723284-79-5 appears in our catalog under these names: (S)-3-Amino-3-(3-fluoro-phenyl)-propionic acid, 98%, (S)–3–Amino–3–(3–fluorophenyl)propanoic acid, H-β-Phe(3-F)-OH 98%, (S)-3-Amino-3-(3-fluorophenyl)propanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g.
(3S)-3-amino-3-(3-fluorophenyl)propanoic acid (CAS 723284-79-5) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: (3S)-3-amino-3-(3-fluorophenyl)propanoic acid. InChIKey: GZNJUJNKZBHINS-QMMMGPOBSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-fluorophenyl)propanoic acid |
| InChIKey | GZNJUJNKZBHINS-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)