CAS 151911-32-9 appears in our catalog under these names: (S)-3-Amino-3-(2-fluoro-phenyl)-propionic acid, 97%, (S)-3-AMINO-3-(2-FLUORO-PHENYL)-PROPIONIC ACID, 97%, 97%, (S)-3-Amino-3-(2-fluorophenyl)propanoic acid, 95%, H-β-Phe(2-F)-OH, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
(3S)-3-amino-3-(2-fluorophenyl)propanoic acid (CAS 151911-32-9) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: (3S)-3-amino-3-(2-fluorophenyl)propanoic acid. InChIKey: RSCLTSJQAQBNCE-QMMMGPOBSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | (3S)-3-amino-3-(2-fluorophenyl)propanoic acid |
| InChIKey | RSCLTSJQAQBNCE-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CC(=O)O)N)F |
Computed by PubChem (NCBI)