cas: 1131605-31-6 — see every product listed under this CAS number, including other names
1-(2-Bromo-4-(trifluoromethyl)phenyl)ethanone, 98% (CAS 1131605-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F464114-250MG |
| cas | 1131605-31-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 10g | 799.74 Pln | |
| Fluorochem | 25g | 1606.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[2-bromo-4-(trifluoromethyl)phenyl]ethanone (CAS 1131605-31-6) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 1-[2-bromo-4-(trifluoromethyl)phenyl]ethanone. InChIKey: HBGXHUPYBNIJTQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 1-[2-bromo-4-(trifluoromethyl)phenyl]ethanone |
| InChIKey | HBGXHUPYBNIJTQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)