CAS 1554936-63-8 is the registry number for 3'-Bromo-4'-Methyl-2,2,2-trifluoroacetophenone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromo-4-methylphenyl)-2,2,2-trifluoroethanone (CAS 1554936-63-8) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 1-(3-bromo-4-methylphenyl)-2,2,2-trifluoroethanone. InChIKey: IBBYHASSXPEMAR-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 1-(3-bromo-4-methylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | IBBYHASSXPEMAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)