Products 1554118-49-8
CAS 1554118-49-8 appears in our catalog under these names: 1-(4-Bromo-3-methylphenyl)-2,2,2-trifluoroethan-1-one, 98%, 1-(4-Bromo-3-methylphenyl)-2,2,2-trifluoroethanone, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanone (CAS 1554118-49-8) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanone. InChIKey: JRPAFFSPQFABQW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | JRPAFFSPQFABQW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)