cas: 160969-00-6 — see every product listed under this CAS number, including other names
1-(2-Bromoethoxy)-2-(2,2,2-trifluoroethoxy)benzene 98+% (CAS 160969-00-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A298213-100g |
| cas | 160969-00-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 21824.94 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2061.38 Pln | |
| Ambeed | 25g | 6172.06 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A298213 |
1-(2-bromoethoxy)-2-(2,2,2-trifluoroethoxy)benzene (CAS 160969-00-6) is a chemical compound with the molecular formula C10H10BrF3O2 and a molecular weight of 299.08 g/mol. IUPAC name: 1-(2-bromoethoxy)-2-(2,2,2-trifluoroethoxy)benzene. InChIKey: BPRQLNDSURZFSX-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O2 |
|---|---|
| Molecular weight | 299.08 g/mol |
| IUPAC name | 1-(2-bromoethoxy)-2-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | BPRQLNDSURZFSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCCBr)OCC(F)(F)F |
Computed by PubChem (NCBI)