CAS 1305802-47-4 is the registry number for 1-(5-Bromo-2-ethoxyphenyl)-2,2,2-trifluoroethan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
1-(5-bromo-2-ethoxyphenyl)-2,2,2-trifluoroethanol (CAS 1305802-47-4) is a chemical compound with the molecular formula C10H10BrF3O2 and a molecular weight of 299.08 g/mol. IUPAC name: 1-(5-bromo-2-ethoxyphenyl)-2,2,2-trifluoroethanol. InChIKey: IISYDVGWJGVFNO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O2 |
|---|---|
| Molecular weight | 299.08 g/mol |
| IUPAC name | 1-(5-bromo-2-ethoxyphenyl)-2,2,2-trifluoroethanol |
| InChIKey | IISYDVGWJGVFNO-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)