cas: 160969-00-6 — see every product listed under this CAS number, including other names
2-[2-(2,2,2-Trifluoroethoxy)phenoxy]ethyl bromide, 98+%, 98+% (CAS 160969-00-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VJK-1g |
| cas | 160969-00-6 |
| size | 1g |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 1581.20 Pln | |
| Chemat | 25g | 4653.20 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
1-(2-bromoethoxy)-2-(2,2,2-trifluoroethoxy)benzene (CAS 160969-00-6) is a chemical compound with the molecular formula C10H10BrF3O2 and a molecular weight of 299.08 g/mol. IUPAC name: 1-(2-bromoethoxy)-2-(2,2,2-trifluoroethoxy)benzene. InChIKey: BPRQLNDSURZFSX-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O2 |
|---|---|
| Molecular weight | 299.08 g/mol |
| IUPAC name | 1-(2-bromoethoxy)-2-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | BPRQLNDSURZFSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCCBr)OCC(F)(F)F |
Computed by PubChem (NCBI)