1-(2-Bromoethoxy)-2-nitrobenzene, 98%
cas: 18800-37-8 — see every product listed under this CAS number, including other names
1-(2-Bromoethoxy)-2-nitrobenzene, 98% (CAS 18800-37-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 25g, 5g, 1g. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | AN-1136-100g |
| cas | 18800-37-8 |
| size | 100g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 100g | 2856.30 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 25g | 676.31 Pln | |
| Ambeed | 100g | 1972.38 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 25g | 674.00 Pln | |
| Chemat | 100g | 1974.80 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 25g | 1242.29 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 286.59 Pln | |
| BLDpharm | 25g | 725.32 Pln | |
| BLDpharm | 100g | 2119.28 Pln | |
| Fluorochem | 500g | 14081.52 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-(2-bromoethoxy)-2-nitrobenzene (CAS 18800-37-8) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 1-(2-bromoethoxy)-2-nitrobenzene. InChIKey: AHOFWSHLRKOJBS-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 1-(2-bromoethoxy)-2-nitrobenzene |
| InChIKey | AHOFWSHLRKOJBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OCCBr |
Computed by PubChem (NCBI)