CAS 1623120-79-5 appears in our catalog under these names: 2-Amino-4-bromo-5-methoxybenzoic acid, 2-Amino-4-bromo-5-methoxy-benzoic acid, 95%, 2-AMino-4-broMo-5-Methoxy-benzoic acid, 98%, 98%, 2-Amino-4-bromo-5-methoxybenzoic acid, 97%, 2-Amino-4-bromo-5-methoxybenzoic acid, 98%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,25g, 1g, 0,5g, 5g, 250mg, 100mg.
2-amino-4-bromo-5-methoxybenzoic acid (CAS 1623120-79-5) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-amino-4-bromo-5-methoxybenzoic acid. InChIKey: AGOBBCBXDHIZOJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-amino-4-bromo-5-methoxybenzoic acid |
| InChIKey | AGOBBCBXDHIZOJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)N)Br |
Computed by PubChem (NCBI)