CAS 35290-97-2 appears in our catalog under these names: 4-Amino-5-bromo-2-methoxybenzenecarboxylic Acid, 4-Amino-5-bromo-2-methoxybenzenecarboxylic acid, 96%, 4-AMINO-5-BROMO-2-METHOXYBENZOIC ACID, 98%, Bromopride Impurity 4, 4-Amino-5-bromo-2-methoxybenzoic acid, 98%, 98%. Offered by: TRC, Combi-blocks, Fluorochem, Chemat Brand, Chemat. Available pack sizes: 1g, 2,5g, 250mg, 10g, 5g, 100mg, on request.
4-amino-5-bromo-2-methoxybenzoic acid (CAS 35290-97-2) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 4-amino-5-bromo-2-methoxybenzoic acid. InChIKey: WHXLHIGUTBQVOF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 4-amino-5-bromo-2-methoxybenzoic acid |
| InChIKey | WHXLHIGUTBQVOF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)Br)N |
Computed by PubChem (NCBI)