1-(2-Bromoethoxy)naphthalene, 95+%
cas: 13247-79-5 — see every product listed under this CAS number, including other names
1-(2-Bromoethoxy)naphthalene, 95+% (CAS 13247-79-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg. Offered by: AmBeed, Chemat, BLDpharm, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A142050-10g |
| cas | 13247-79-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16065.07 Pln | |
| AmBeed | 5g | 10733.38 Pln | |
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1555.19 Pln | |
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1168.40 Pln | |
| Chemat | 1g | 2795.60 Pln | |
| BLDpharm | 100mg | 480.97 Pln | |
| BLDpharm | 250mg | 647.57 Pln | |
| BLDpharm | 1g | 1674.99 Pln | |
| Fluorochem | 100mg | 1263.11 Pln | |
| Fluorochem | 250mg | 2163.84 Pln | |
| Fluorochem | 1g | 5183.61 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-bromoethoxy)naphthalene (CAS 13247-79-5) is a chemical compound with the molecular formula C12H11BrO and a molecular weight of 251.12 g/mol. IUPAC name: 1-(2-bromoethoxy)naphthalene. InChIKey: OBGFJKNQKBMXBM-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 1-(2-bromoethoxy)naphthalene |
| InChIKey | OBGFJKNQKBMXBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OCCBr |
Computed by PubChem (NCBI)