CAS 1781457-40-6 appears in our catalog under these names: 6'-Bromo-2',3'-dihydro-4'H-spiro[cyclopropane-1,1'-naphthalen]-4'-one, 98%, 6'-Bromo-2',3'-dihydro-4'h-spiro[cyclopropane-1,1'-naphthalen]-4'-one, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
7-bromospiro[2,3-dihydronaphthalene-4,1'-cyclopropane]-1-one (CAS 1781457-40-6) is a chemical compound with the molecular formula C12H11BrO and a molecular weight of 251.12 g/mol. IUPAC name: 7-bromospiro[2,3-dihydronaphthalene-4,1'-cyclopropane]-1-one. InChIKey: PUFDLIGDJYJZBI-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 7-bromospiro[2,3-dihydronaphthalene-4,1'-cyclopropane]-1-one |
| InChIKey | PUFDLIGDJYJZBI-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2)C3=C(C1=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)