CAS 2077989-33-2 is the registry number for 8'-Bromo-3',4'-dihydro-1'H-spiro[cyclopropane-1,2'-naphthalen]-1'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromospiro[3,4-dihydronaphthalene-2,1'-cyclopropane]-1-one (CAS 2077989-33-2) is a chemical compound with the molecular formula C12H11BrO and a molecular weight of 251.12 g/mol. IUPAC name: 8-bromospiro[3,4-dihydronaphthalene-2,1'-cyclopropane]-1-one. InChIKey: VVOYBNYPQMHGQS-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 8-bromospiro[3,4-dihydronaphthalene-2,1'-cyclopropane]-1-one |
| InChIKey | VVOYBNYPQMHGQS-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2)C(=O)C3=C1C=CC=C3Br |
Computed by PubChem (NCBI)