cas: 1090783-85-9 — see every product listed under this CAS number, including other names
1-(2-Chloro-6-nitrophenyl)-4-methylpiperidine, 98%, 98% (CAS 1090783-85-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPN-1g |
| cas | 1090783-85-9 |
| size | 1g |
| availability | 19g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 683.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(2-chloro-6-nitrophenyl)-4-methylpiperidine (CAS 1090783-85-9) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 1-(2-chloro-6-nitrophenyl)-4-methylpiperidine. InChIKey: RKLQJMZOJIPGMX-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 1-(2-chloro-6-nitrophenyl)-4-methylpiperidine |
| InChIKey | RKLQJMZOJIPGMX-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=CC=C2Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)