cas: 1090783-85-9 — see every product listed under this CAS number, including other names
1-(2-Chloro-6-nitrophenyl)-4-methylpiperidine, 98% (CAS 1090783-85-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F697188-1G |
| cas | 1090783-85-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 763.29 Pln | |
| Fluorochem | 10g | 1101.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(2-chloro-6-nitrophenyl)-4-methylpiperidine (CAS 1090783-85-9) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 1-(2-chloro-6-nitrophenyl)-4-methylpiperidine. InChIKey: RKLQJMZOJIPGMX-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 1-(2-chloro-6-nitrophenyl)-4-methylpiperidine |
| InChIKey | RKLQJMZOJIPGMX-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=CC=C2Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)