Products 721900-06-7
CAS 721900-06-7 appears in our catalog under these names: 2-Chloro-n-methyl-n-(p-tolylcarbamoyl-methyl)-acetamide, 95%, 2-Chloro-N-methyl-N-{((4-methylphenyl)carbamoyl)methyl}acetamide, 95%, 2-Chloro-N-methyl-N-{((4-methylphenyl)carbamoyl)methyl}acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 2,5g.
2-[(2-chloroacetyl)-methylamino]-N-(4-methylphenyl)acetamide (CAS 721900-06-7) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 2-[(2-chloroacetyl)-methylamino]-N-(4-methylphenyl)acetamide. InChIKey: VTCGNTYQBBRWBX-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 2-[(2-chloroacetyl)-methylamino]-N-(4-methylphenyl)acetamide |
| InChIKey | VTCGNTYQBBRWBX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)CN(C)C(=O)CCl |
Computed by PubChem (NCBI)