cas: 830346-46-8 — see every product listed under this CAS number, including other names
1-(2-Fluoro-6-(trifluoromethyl)benzyl)urea, 98% (CAS 830346-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0D9-100mg |
| cas | 830346-46-8 |
| size | 100mg |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 328.40 Pln | |
| Chemat | 25g | 554.00 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 10g | 544.62 Pln | |
| Fluorochem | 25g | 732.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2-fluoro-6-(trifluoromethyl)phenyl]methylurea (CAS 830346-46-8) is a chemical compound with the molecular formula C9H8F4N2O and a molecular weight of 236.17 g/mol. IUPAC name: [2-fluoro-6-(trifluoromethyl)phenyl]methylurea. InChIKey: NLKRQVSNIXWLBR-UHFFFAOYSA-N.
| Molecular formula | C9H8F4N2O |
|---|---|
| Molecular weight | 236.17 g/mol |
| IUPAC name | [2-fluoro-6-(trifluoromethyl)phenyl]methylurea |
| InChIKey | NLKRQVSNIXWLBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CNC(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)