1-(2-Fluorophenyl)-2-phenylethanone, 95+%
cas: 77294-82-7 — see every product listed under this CAS number, including other names
1-(2-Fluorophenyl)-2-phenylethanone, 95+% (CAS 77294-82-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A290347-250mg |
| cas | 77294-82-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3073.75 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 765.20 Pln | |
| Chemat | 5g | 2522.00 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 503.18 Pln | |
| BLDpharm | 1g | 1169.61 Pln | |
| BLDpharm | 5g | 3313.30 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
1-(2-fluorophenyl)-2-phenylethanone (CAS 77294-82-7) is a chemical compound with the molecular formula C14H11FO and a molecular weight of 214.23 g/mol. IUPAC name: 1-(2-fluorophenyl)-2-phenylethanone. InChIKey: ZAKNRBRFLQSIBK-UHFFFAOYSA-N.
| Molecular formula | C14H11FO |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-2-phenylethanone |
| InChIKey | ZAKNRBRFLQSIBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)