CAS 40281-50-3 appears in our catalog under these names: 3'-Fluoro-2-phenylacetophenone, 95%, 1-(3-Fluorophenyl)-2-phenylethanone 95%, 3'-Fluoro-2-phenylacetophenone, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
1-(3-fluorophenyl)-2-phenylethanone (CAS 40281-50-3) is a chemical compound with the molecular formula C14H11FO and a molecular weight of 214.23 g/mol. IUPAC name: 1-(3-fluorophenyl)-2-phenylethanone. InChIKey: YCSLTCUBFAFEGB-UHFFFAOYSA-N.
| Molecular formula | C14H11FO |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2-phenylethanone |
| InChIKey | YCSLTCUBFAFEGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)