CAS 1334220-37-9 is the registry number for 4'-Fluoro-2-methyl-[1,1'-biphenyl]-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-(4-fluorophenyl)-3-methylbenzaldehyde (CAS 1334220-37-9) is a chemical compound with the molecular formula C14H11FO and a molecular weight of 214.23 g/mol. IUPAC name: 4-(4-fluorophenyl)-3-methylbenzaldehyde. InChIKey: NSJKWZBSDKJZDW-UHFFFAOYSA-N.
| Molecular formula | C14H11FO |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-3-methylbenzaldehyde |
| InChIKey | NSJKWZBSDKJZDW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)