cas: 1108712-66-8 — see every product listed under this CAS number, including other names
1-(2-Methoxyethyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid, 97% (CAS 1108712-66-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A479436-5g |
| cas | 1108712-66-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 12360.88 Pln | |
| AmBeed | 10g | 14938.84 Pln | |
| AmBeed | 1g | 10225.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-methoxyethyl)-3,5-dimethylpyrazole-4-carboxylic acid (CAS 1108712-66-8) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: 1-(2-methoxyethyl)-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: ZRCIUCCLIMARHS-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 1-(2-methoxyethyl)-3,5-dimethylpyrazole-4-carboxylic acid |
| InChIKey | ZRCIUCCLIMARHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCOC)C)C(=O)O |
Computed by PubChem (NCBI)