CAS 2365420-05-7 appears in our catalog under these names: tert-Butyl 2-(5-methyl-1,2,4-oxadiazol-3-yl)acetate, 96%, tert-Butyl 2-(5-methyl-1,2,4-oxadiazol-3-yl)acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 25g, 10g.
Tert-butyl 2-(5-methyl-1,2,4-oxadiazol-3-yl)acetate (CAS 2365420-05-7) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 2-(5-methyl-1,2,4-oxadiazol-3-yl)acetate. InChIKey: JRCBXADSMWDBRB-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 2-(5-methyl-1,2,4-oxadiazol-3-yl)acetate |
| InChIKey | JRCBXADSMWDBRB-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)CC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)