CAS 915396-44-0 appears in our catalog under these names: 3-Hydroxy-5-methyl-pyrazole-1-carboxylic acid tert-butyl ester, 96%, 3-Hydroxy-5-methyl-pyrazole-1-carboxylic acid tert-butyl ester, 98+%, 98+%, tert-butyl 5-methyl-3-oxo-2,3-dihydro-1H-pyrazole-1-carboxylate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
Tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate (CAS 915396-44-0) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate. InChIKey: OKWSLQHJNUSTSW-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate |
| InChIKey | OKWSLQHJNUSTSW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)