cas: 59084-06-9 — see every product listed under this CAS number, including other names
1-(2-Nitrophenyl)piperazine, 97% (CAS 59084-06-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019232-1G |
| cas | 59084-06-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 268.67 Pln | |
| Fluorochem | 25g | 471.73 Pln | |
| Fluorochem | 100g | 1611.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(2-nitrophenyl)piperazine (CAS 59084-06-9) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 1-(2-nitrophenyl)piperazine. InChIKey: YJRCDSXLKPERNV-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 1-(2-nitrophenyl)piperazine |
| InChIKey | YJRCDSXLKPERNV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)