CAS 54054-85-2 appears in our catalog under these names: 1-(3-nitrophenyl)piperazine, 97%, 1-(3-Nitrophenyl)-piperazine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g.
1-(3-nitrophenyl)piperazine (CAS 54054-85-2) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 1-(3-nitrophenyl)piperazine. InChIKey: LHHZRIYUOZPKSG-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 1-(3-nitrophenyl)piperazine |
| InChIKey | LHHZRIYUOZPKSG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)