CAS 61239-35-8 is the registry number for 2-(N-Hydroxycarbamimidoyl)-n-p-tolyl-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(3Z)-3-amino-3-hydroxyimino-N-(4-methylphenyl)propanamide (CAS 61239-35-8) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: (3Z)-3-amino-3-hydroxyimino-N-(4-methylphenyl)propanamide. InChIKey: UFIVRVJPTARXGK-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | (3Z)-3-amino-3-hydroxyimino-N-(4-methylphenyl)propanamide |
| InChIKey | UFIVRVJPTARXGK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C/C(=N/O)/N |
Computed by PubChem (NCBI)