cas: 84485-58-5 — see every product listed under this CAS number, including other names
1-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid 98% (CAS 84485-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A214316-100mg |
| cas | 84485-58-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1877.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A214316 |
1-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid (CAS 84485-58-5) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid. InChIKey: LKLDQXZDZVETAB-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | LKLDQXZDZVETAB-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)