Products 1781330-59-3

CAS 1781330-59-3 is the registry number for 1-(3,4-Dichloro-phenyl)-cyclopropanecarboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 1-(3,4-dichlorophenyl)cyclopropane-1-carboxylate (CAS 1781330-59-3) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: methyl 1-(3,4-dichlorophenyl)cyclopropane-1-carboxylate. InChIKey: YPZHYWIMIAFVGN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10Cl2O2
Molecular weight245.10 g/mol
IUPAC namemethyl 1-(3,4-dichlorophenyl)cyclopropane-1-carboxylate
InChIKeyYPZHYWIMIAFVGN-UHFFFAOYSA-N
SMILESCOC(=O)C1(CC1)C2=CC(=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)