CAS 84485-58-5 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid, 95%, 1-(3,4-Dichlorophenyl)cyclobutane-1-carboxylic acid, 1-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid 98%, 1-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid, 98%, 98%, 1-(3,4-DICHLOROPHENYL)CYCLOBUTANECARBOXYLIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 100mg, 250mg.
1-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid (CAS 84485-58-5) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid. InChIKey: LKLDQXZDZVETAB-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | LKLDQXZDZVETAB-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)