cas: 857565-71-0 — see every product listed under this CAS number, including other names
1-(3,4-Dimethoxy-2-nitrophenyl)ethanone, 98% (CAS 857565-71-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692774-100MG |
| cas | 857565-71-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 1158.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(3,4-dimethoxy-2-nitrophenyl)ethanone (CAS 857565-71-0) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: 1-(3,4-dimethoxy-2-nitrophenyl)ethanone. InChIKey: SLMBURGYPGSXJL-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 1-(3,4-dimethoxy-2-nitrophenyl)ethanone |
| InChIKey | SLMBURGYPGSXJL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)OC)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)