Products 41516-33-0
CAS 41516-33-0 is the registry number for 3,4-dimethyl 2-hydroxy-6-methylpyridine-3,4-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Dimethyl 6-methyl-2-oxo-1H-pyridine-3,4-dicarboxylate (CAS 41516-33-0) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: dimethyl 6-methyl-2-oxo-1H-pyridine-3,4-dicarboxylate. InChIKey: DVPMNTVACSJSMB-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | dimethyl 6-methyl-2-oxo-1H-pyridine-3,4-dicarboxylate |
| InChIKey | DVPMNTVACSJSMB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)