CAS 871085-51-7 appears in our catalog under these names: 4-Hydroxy-3-nitro-5-propoxy-benzaldehyde, 95%, 4-Hydroxy-3-nitro-5-propoxybenzaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
4-hydroxy-3-nitro-5-propoxybenzaldehyde (CAS 871085-51-7) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: 4-hydroxy-3-nitro-5-propoxybenzaldehyde. InChIKey: XOTMRYLMVFWNPI-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 4-hydroxy-3-nitro-5-propoxybenzaldehyde |
| InChIKey | XOTMRYLMVFWNPI-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC(=CC(=C1O)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)