cas: 1343855-95-7 — see every product listed under this CAS number, including other names
1-(3,5-Dichlorophenyl)propan-1-ol, 95%, 95% (CAS 1343855-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DYOD-100mg |
| cas | 1343855-95-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1576.40 Pln | |
| Chemat | 250mg | 2541.20 Pln | |
| Chemat | 1g | 5022.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3,5-dichlorophenyl)propan-1-ol (CAS 1343855-95-7) is a chemical compound with the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)propan-1-ol. InChIKey: MSDKSQHCPYGRGP-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)propan-1-ol |
| InChIKey | MSDKSQHCPYGRGP-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)